C21H23N7O — CID 142607778
N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-8-(6-methoxy-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 142607778) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-8-(6-methoxy-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-8-(6-methoxy-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 142607778 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-8-(6-methoxy-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CCn1ncc2c1CCC(Nc1nc3c(-c4ccc(OC)nc4)cccn3n1)C2 |
| InChI | InChI=1S/C21H23N7O/c1-3-27-18-8-7-16(11-15(18)13-23-27)24-21-25-20-17(5-4-10-28(20)26-21)14-6-9-19(29-2)22-12-14/h4-6,9-10,12-13,16H,3,7-8,11H2,1-2H3,(H,24,26) |
| InChIKey | IIJCPDFRXNMOQQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |