C20H20ClN7 — CID 142607816
8-(5-chloro-3-pyridinyl)-N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 142607816) has the molecular formula C20H20ClN7 and a molecular weight of 393.88 g/mol. Its IUPAC name is 8-(5-chloro-3-pyridinyl)-N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(5-chloro-3-pyridinyl)-N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 142607816 |
| Molecular Formula | C20H20ClN7 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 8-(5-chloro-3-pyridinyl)-N-(1-ethyl-4,5,6,7-tetrahydroindazol-5-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CCn1ncc2c1CCC(Nc1nc3c(-c4cncc(Cl)c4)cccn3n1)C2 |
| InChI | InChI=1S/C20H20ClN7/c1-2-27-18-6-5-16(9-14(18)11-23-27)24-20-25-19-17(4-3-7-28(19)26-20)13-8-15(21)12-22-10-13/h3-4,7-8,10-12,16H,2,5-6,9H2,1H3,(H,24,26) |
| InChIKey | YYGKOOZHHBFTGY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |