C13H24N2 — CID 142607873
ethane;1-ethyl-5,7-dimethyl-4,5,6,7-tetrahydroindazole (PubChem CID 142607873) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;1-ethyl-5,7-dimethyl-4,5,6,7-tetrahydroindazole.
| Compound Name | ethane;1-ethyl-5,7-dimethyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 142607873 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;1-ethyl-5,7-dimethyl-4,5,6,7-tetrahydroindazole |
| SMILES | CC.CCn1ncc2c1C(C)CC(C)C2 |
| InChI | InChI=1S/C11H18N2.C2H6/c1-4-13-11-9(3)5-8(2)6-10(11)7-12-13;1-2/h7-9H,4-6H2,1-3H3;1-2H3 |
| InChIKey | OFHJFVKIKHEISO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |