C21H25N5O3 — CID 142608393
5-(2-ethoxy-3-pyridinyl)-N,1-bis(oxolan-3-yl)pyrazolo[4,5-b]pyridin-7-amine (PubChem CID 142608393) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-(2-ethoxy-3-pyridinyl)-N,1-bis(oxolan-3-yl)pyrazolo[4,5-b]pyridin-7-amine.
| Compound Name | 5-(2-ethoxy-3-pyridinyl)-N,1-bis(oxolan-3-yl)pyrazolo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 142608393 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5-(2-ethoxy-3-pyridinyl)-N,1-bis(oxolan-3-yl)pyrazolo[4,5-b]pyridin-7-amine |
| SMILES | CCOc1ncccc1-c1cc(NC2CCOC2)c2c(cnn2C2CCOC2)n1 |
| InChI | InChI=1S/C21H25N5O3/c1-2-29-21-16(4-3-7-22-21)17-10-18(24-14-5-8-27-12-14)20-19(25-17)11-23-26(20)15-6-9-28-13-15/h3-4,7,10-11,14-15H,2,5-6,8-9,12-13H2,1H3,(H,24,25) |
| InChIKey | RUXLOBIFDNRKTD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |