C15H17N5O — CID 142608517
5-(2-ethoxy-3-pyridinyl)-1-ethylpyrazolo[4,5-b]pyridin-7-amine (PubChem CID 142608517) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is 5-(2-ethoxy-3-pyridinyl)-1-ethylpyrazolo[4,5-b]pyridin-7-amine.
| Compound Name | 5-(2-ethoxy-3-pyridinyl)-1-ethylpyrazolo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 142608517 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-(2-ethoxy-3-pyridinyl)-1-ethylpyrazolo[4,5-b]pyridin-7-amine |
| SMILES | CCOc1ncccc1-c1cc(N)c2c(cnn2CC)n1 |
| InChI | InChI=1S/C15H17N5O/c1-3-20-14-11(16)8-12(19-13(14)9-18-20)10-6-5-7-17-15(10)21-4-2/h5-9H,3-4H2,1-2H3,(H2,16,19) |
| InChIKey | UFBJCRFDAOCIMA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |