C18H29BrN2O — CID 142608750
2-[[(5-bromo-2-methylphenyl)-cyclohexylmethyl]amino]propanamide;methane (PubChem CID 142608750) has the molecular formula C18H29BrN2O and a molecular weight of 369.35 g/mol. Its IUPAC name is 2-[[(5-bromo-2-methylphenyl)-cyclohexylmethyl]amino]propanamide;methane.
| Compound Name | 2-[[(5-bromo-2-methylphenyl)-cyclohexylmethyl]amino]propanamide;methane |
|---|---|
| PubChem CID | 142608750 |
| Molecular Formula | C18H29BrN2O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[[(5-bromo-2-methylphenyl)-cyclohexylmethyl]amino]propanamide;methane |
| SMILES | C.Cc1ccc(Br)cc1C(NC(C)C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C17H25BrN2O.CH4/c1-11-8-9-14(18)10-15(11)16(20-12(2)17(19)21)13-6-4-3-5-7-13;/h8-10,12-13,16,20H,3-7H2,1-2H3,(H2,19,21);1H4 |
| InChIKey | LUGIJURDBGFIBH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |