C24H32N2O2Si — CID 142608803
4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]-3-methylbutanoic acid (PubChem CID 142608803) has the molecular formula C24H32N2O2Si and a molecular weight of 408.62 g/mol. Its IUPAC name is 4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]-3-methylbutanoic acid.
| Compound Name | 4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 142608803 |
| Molecular Formula | C24H32N2O2Si |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]-3-methylbutanoic acid |
| SMILES | CC(C=C1c2ccc(N(C)C)cc2[Si](C)(C)c2cc(N(C)C)ccc21)CC(=O)O |
| InChI | InChI=1S/C24H32N2O2Si/c1-16(13-24(27)28)12-21-19-10-8-17(25(2)3)14-22(19)29(6,7)23-15-18(26(4)5)9-11-20(21)23/h8-12,14-16H,13H2,1-7H3,(H,27,28) |
| InChIKey | ASIVLJNZNJECQS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|