About 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol
5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol (PubChem CID 142608910) has the molecular formula C7H8N4S
and a molecular weight of 180.24 g/mol. Its IUPAC name is 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol.
Molecular Properties
| Compound Name | 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol |
| PubChem CID | 142608910 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol |
| SMILES | CC1(S)C=NC=c2[nH]cnc2=N1 |
| InChI | InChI=1S/C7H8N4S/c1-7(12)3-8-2-5-6(11-7)10-4-9-5/h2-4,12H,1H3,(H,9,10,11) |
| InChIKey | LYOIWLTYWYUNKX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol?
The IUPAC name of 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol (CID 142608910) is 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol.
What is the SMILES notation for 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol?
The canonical SMILES for 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol is CC1(S)C=NC=c2[nH]cnc2=N1.
What is the InChIKey of 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol?
The InChIKey is LYOIWLTYWYUNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S/c1-7(12)3-8-2-5-6(11-7)10-4-9-5/h2-4,12H,1H3,(H,9,10,11).
What are the key properties of 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol?
5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol has a molecular weight of 180.24 g/mol, XLogP of -0.50, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-imidazo[4,5-e][1,4]diazepine-5-thiol is sourced from PubChem (CID 142608910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).