About 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide
4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide (PubChem CID 142609116) has the molecular formula C16H12Cl2N4O2
and a molecular weight of 363.20 g/mol. Its IUPAC name is 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide |
| PubChem CID | 142609116 |
| Molecular Formula | C16H12Cl2N4O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide |
| SMILES | Nc1nc(-c2ccco2)ncc1C(=O)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H12Cl2N4O2/c17-11-3-1-4-12(18)9(11)7-21-16(23)10-8-20-15(22-14(10)19)13-5-2-6-24-13/h1-6,8H,7H2,(H,21,23)(H2,19,20,22) |
| InChIKey | MTHAGVFQTSFTCU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide?
The IUPAC name of 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide (CID 142609116) is 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide.
What is the SMILES notation for 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide?
The canonical SMILES for 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide is Nc1nc(-c2ccco2)ncc1C(=O)NCc1c(Cl)cccc1Cl.
What is the InChIKey of 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide?
The InChIKey is MTHAGVFQTSFTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N4O2/c17-11-3-1-4-12(18)9(11)7-21-16(23)10-8-20-15(22-14(10)19)13-5-2-6-24-13/h1-6,8H,7H2,(H,21,23)(H2,19,20,22).
What are the key properties of 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide?
4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide has a molecular weight of 363.20 g/mol, XLogP of 3.56, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[(2,6-dichlorophenyl)methyl]-2-(furan-2-yl)pyrimidine-5-carboxamide is sourced from PubChem (CID 142609116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).