C6H7N5S — CID 142609248
3-ethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole (PubChem CID 142609248) has the molecular formula C6H7N5S and a molecular weight of 181.22 g/mol. Its IUPAC name is 3-ethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 142609248 |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 3-ethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazole |
| SMILES | CCc1nsc(-c2ncn[nH]2)n1 |
| InChI | InChI=1S/C6H7N5S/c1-2-4-9-6(12-11-4)5-7-3-8-10-5/h3H,2H2,1H3,(H,7,8,10) |
| InChIKey | OABMLJTXLAPMNZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |