About ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen
ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen (PubChem CID 142609647) has the molecular formula C20H40N2O3
and a molecular weight of 356.55 g/mol. Its IUPAC name is ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen |
| PubChem CID | 142609647 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen |
| SMILES | CC.CC/C=C/C(=O)NCCCN1CCC(OCC(=O)C(C)C)CC1.[H][H] |
| InChI | InChI=1S/C18H32N2O3.C2H6.H2/c1-4-5-7-18(22)19-10-6-11-20-12-8-16(9-13-20)23-14-17(21)15(2)3;1-2;/h5,7,15-16H,4,6,8-14H2,1-3H3,(H,19,22);1-2H3;1H/b7-5+;; |
| InChIKey | VKEGOVAWGRIJOU-WVKUUHRJSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen?
The IUPAC name of ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen (CID 142609647) is ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen.
What is the SMILES notation for ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen?
The canonical SMILES for ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen is CC.CC/C=C/C(=O)NCCCN1CCC(OCC(=O)C(C)C)CC1.[H][H].
What is the InChIKey of ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen?
The InChIKey is VKEGOVAWGRIJOU-WVKUUHRJSA-N. The full InChI is InChI=1S/C18H32N2O3.C2H6.H2/c1-4-5-7-18(22)19-10-6-11-20-12-8-16(9-13-20)23-14-17(21)15(2)3;1-2;/h5,7,15-16H,4,6,8-14H2,1-3H3,(H,19,22);1-2H3;1H/b7-5+;;.
What are the key properties of ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen?
ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen has a molecular weight of 356.55 g/mol, XLogP of 3.44, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-N-[3-[4-(3-methyl-2-oxobutoxy)piperidin-1-yl]propyl]pent-2-enamide;molecular hydrogen is sourced from PubChem (CID 142609647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).