C31H37F5N2O3 — CID 142609683
2-[8-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2,2-difluorooctoxy]acetic acid (PubChem CID 142609683) has the molecular formula C31H37F5N2O3 and a molecular weight of 580.64 g/mol. Its IUPAC name is 2-[8-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2,2-difluorooctoxy]acetic acid.
| Compound Name | 2-[8-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2,2-difluorooctoxy]acetic acid |
|---|---|
| PubChem CID | 142609683 |
| Molecular Formula | C31H37F5N2O3 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 2-[8-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2,2-difluorooctoxy]acetic acid |
| SMILES | CC(C)(F)CN1CCc2c([nH]c3ccccc23)C1c1c(F)cc(CCCCCCC(F)(F)COCC(=O)O)cc1F |
| InChI | InChI=1S/C31H37F5N2O3/c1-30(2,34)18-38-14-12-22-21-10-6-7-11-25(21)37-28(22)29(38)27-23(32)15-20(16-24(27)33)9-5-3-4-8-13-31(35,36)19-41-17-26(39)40/h6-7,10-11,15-16,29,37H,3-5,8-9,12-14,17-19H2,1-2H3,(H,39,40) |
| InChIKey | QOBWUIZXRKNLMD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|