About 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate
2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate (PubChem CID 142609743) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate |
| PubChem CID | 142609743 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCOC(=O)C(C)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C17H30O4/c1-12(2)15(18)20-9-10-21-16(19)13(3)14-7-6-8-17(4,5)11-14/h12-14H,6-11H2,1-5H3 |
| InChIKey | DSHMJPJQNIURMO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate?
The IUPAC name of 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate (CID 142609743) is 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate.
What is the SMILES notation for 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate?
The canonical SMILES for 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate is CC(C)C(=O)OCCOC(=O)C(C)C1CCCC(C)(C)C1.
What is the InChIKey of 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate?
The InChIKey is DSHMJPJQNIURMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O4/c1-12(2)15(18)20-9-10-21-16(19)13(3)14-7-6-8-17(4,5)11-14/h12-14H,6-11H2,1-5H3.
What are the key properties of 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate?
2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate has a molecular weight of 298.42 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl 2-methylpropanoate is sourced from PubChem (CID 142609743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).