About 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate
2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate (PubChem CID 142609756) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate |
| PubChem CID | 142609756 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate |
| SMILES | CC(OCCOC(=O)C1CC1)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H28O3/c1-12(14-5-4-8-16(2,3)11-14)18-9-10-19-15(17)13-6-7-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | LBLGKXDFGFXCHB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate?
The IUPAC name of 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate (CID 142609756) is 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate.
What is the SMILES notation for 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate?
The canonical SMILES for 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate is CC(OCCOC(=O)C1CC1)C1CCCC(C)(C)C1.
What is the InChIKey of 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate?
The InChIKey is LBLGKXDFGFXCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-12(14-5-4-8-16(2,3)11-14)18-9-10-19-15(17)13-6-7-13/h12-14H,4-11H2,1-3H3.
What are the key properties of 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate?
2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate has a molecular weight of 268.40 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-dimethylcyclohexyl)ethoxy]ethyl cyclopropanecarboxylate is sourced from PubChem (CID 142609756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).