C6H13N5 — CID 142610442
N'-[(1E)-1,2,3-triaminobuta-1,3-dienyl]ethanimidamide (PubChem CID 142610442) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is N'-[(1E)-1,2,3-triaminobuta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1E)-1,2,3-triaminobuta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 142610442 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | N'-[(1E)-1,2,3-triaminobuta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(N)/C(N)=C(N)\N=C(/C)N |
| InChI | InChI=1S/C6H13N5/c1-3(7)5(9)6(10)11-4(2)8/h1,7,9-10H2,2H3,(H2,8,11)/b6-5+ |
| InChIKey | SGGXCOZYYYVSSW-AATRIKPKSA-N |
| XLogP | -1.08 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|