About (1Z)-3-methylbuta-1,3-diene-1,2-diamine
(1Z)-3-methylbuta-1,3-diene-1,2-diamine (PubChem CID 142610484) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is (1Z)-3-methylbuta-1,3-diene-1,2-diamine.
Molecular Properties
| Compound Name | (1Z)-3-methylbuta-1,3-diene-1,2-diamine |
| PubChem CID | 142610484 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | (1Z)-3-methylbuta-1,3-diene-1,2-diamine |
| SMILES | C=C(C)/C(N)=C/N |
| InChI | InChI=1S/C5H10N2/c1-4(2)5(7)3-6/h3H,1,6-7H2,2H3/b5-3- |
| InChIKey | ZLISHCRBYJVJDH-HYXAFXHYSA-N |
| XLogP | 0.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3-methylbuta-1,3-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3-methylbuta-1,3-diene-1,2-diamine?
The IUPAC name of (1Z)-3-methylbuta-1,3-diene-1,2-diamine (CID 142610484) is (1Z)-3-methylbuta-1,3-diene-1,2-diamine.
What is the SMILES notation for (1Z)-3-methylbuta-1,3-diene-1,2-diamine?
The canonical SMILES for (1Z)-3-methylbuta-1,3-diene-1,2-diamine is C=C(C)/C(N)=C/N.
What is the InChIKey of (1Z)-3-methylbuta-1,3-diene-1,2-diamine?
The InChIKey is ZLISHCRBYJVJDH-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H10N2/c1-4(2)5(7)3-6/h3H,1,6-7H2,2H3/b5-3-.
What are the key properties of (1Z)-3-methylbuta-1,3-diene-1,2-diamine?
(1Z)-3-methylbuta-1,3-diene-1,2-diamine has a molecular weight of 98.15 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3-methylbuta-1,3-diene-1,2-diamine is sourced from PubChem (CID 142610484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).