About 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one
1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one (PubChem CID 142610878) has the molecular formula C18H20N2OS
and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one |
| PubChem CID | 142610878 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CSc1ncc2c(n1)-c1ccccc1CC2 |
| InChI | InChI=1S/C18H20N2OS/c1-18(2,3)15(21)11-22-17-19-10-13-9-8-12-6-4-5-7-14(12)16(13)20-17/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | UAIJKIVHEOQCKS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one?
The IUPAC name of 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one (CID 142610878) is 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CSc1ncc2c(n1)-c1ccccc1CC2.
What is the InChIKey of 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one?
The InChIKey is UAIJKIVHEOQCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2OS/c1-18(2,3)15(21)11-22-17-19-10-13-9-8-12-6-4-5-7-14(12)16(13)20-17/h4-7,10H,8-9,11H2,1-3H3.
What are the key properties of 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one?
1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one has a molecular weight of 312.44 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dihydrobenzo[h]quinazolin-2-ylsulfanyl)-3,3-dimethylbutan-2-one is sourced from PubChem (CID 142610878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).