C22H15ClF8N6O — CID 142611033
2-[[[5-chloro-2-[8-[(3,5-difluoro-4-methylphenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 142611033) has the molecular formula C22H15ClF8N6O and a molecular weight of 566.84 g/mol. Its IUPAC name is 2-[[[5-chloro-2-[8-[(3,5-difluoro-4-methylphenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[[5-chloro-2-[8-[(3,5-difluoro-4-methylphenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 142611033 |
| Molecular Formula | C22H15ClF8N6O |
| Molecular Weight | 566.84 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | 2-[[[5-chloro-2-[8-[(3,5-difluoro-4-methylphenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1c(F)cc(Cc2nc(-c3ncc(Cl)c(NCC(O)(C(F)(F)F)C(F)(F)F)n3)cn3ccnc23)cc1F |
| InChI | InChI=1S/C22H15ClF8N6O/c1-10-13(24)4-11(5-14(10)25)6-15-19-32-2-3-37(19)8-16(35-15)18-33-7-12(23)17(36-18)34-9-20(38,21(26,27)28)22(29,30)31/h2-5,7-8,38H,6,9H2,1H3,(H,33,34,36) |
| InChIKey | OYGHQKUZMZHMNE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.84 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |