About azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine
azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine (PubChem CID 142611226) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine.
Molecular Properties
| Compound Name | azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine |
| PubChem CID | 142611226 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine |
| SMILES | C=CC1=C(\C=C)N(C)Cc2ccccc2/C=C\1.N |
| InChI | InChI=1S/C16H17N.H3N/c1-4-13-10-11-14-8-6-7-9-15(14)12-17(3)16(13)5-2;/h4-11H,1-2,12H2,3H3;1H3/b11-10-,16-13-; |
| InChIKey | VJUUVCZBKHAHHO-IUVZNSLHSA-N |
| XLogP | 3.93 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine?
The IUPAC name of azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine (CID 142611226) is azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine.
What is the SMILES notation for azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine?
The canonical SMILES for azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine is C=CC1=C(\C=C)N(C)Cc2ccccc2/C=C\1.N.
What is the InChIKey of azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine?
The InChIKey is VJUUVCZBKHAHHO-IUVZNSLHSA-N. The full InChI is InChI=1S/C16H17N.H3N/c1-4-13-10-11-14-8-6-7-9-15(14)12-17(3)16(13)5-2;/h4-11H,1-2,12H2,3H3;1H3/b11-10-,16-13-;.
What are the key properties of azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine?
azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine has a molecular weight of 240.35 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(3Z,5Z)-3,4-bis(ethenyl)-2-methyl-1H-2-benzazocine is sourced from PubChem (CID 142611226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).