C27H25N5O3 — CID 142612762
11-methyl-6-[5-[4-(morpholine-4-carbonyl)phenyl]-3-pyridinyl]-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one (PubChem CID 142612762) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 11-methyl-6-[5-[4-(morpholine-4-carbonyl)phenyl]-3-pyridinyl]-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one.
| Compound Name | 11-methyl-6-[5-[4-(morpholine-4-carbonyl)phenyl]-3-pyridinyl]-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 142612762 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 11-methyl-6-[5-[4-(morpholine-4-carbonyl)phenyl]-3-pyridinyl]-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
| SMILES | CN1CCn2c(cc3c(-c4cncc(-c5ccc(C(=O)N6CCOCC6)cc5)c4)ccnc32)C1=O |
| InChI | InChI=1S/C27H25N5O3/c1-30-8-9-32-24(27(30)34)15-23-22(6-7-29-25(23)32)21-14-20(16-28-17-21)18-2-4-19(5-3-18)26(33)31-10-12-35-13-11-31/h2-7,14-17H,8-13H2,1H3 |
| InChIKey | NUPWLLFFSARTFK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|