About 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane
2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane (PubChem CID 142613047) has the molecular formula C25H43N3O2
and a molecular weight of 417.64 g/mol. Its IUPAC name is 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane.
Molecular Properties
| Compound Name | 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane |
| PubChem CID | 142613047 |
| Molecular Formula | C25H43N3O2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane |
| SMILES | CC(=CO)c1cnn2c(C)cc(C)nc12.CCCC1CCCCC1.CCCCCO |
| InChI | InChI=1S/C11H13N3O.C9H18.C5H12O/c1-7(6-15)10-5-12-14-9(3)4-8(2)13-11(10)14;1-2-6-9-7-4-3-5-8-9;1-2-3-4-5-6/h4-6,15H,1-3H3;9H,2-8H2,1H3;6H,2-5H2,1H3 |
| InChIKey | YGSZYMMFUPVAOW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane?
The IUPAC name of 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane (CID 142613047) is 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane.
What is the SMILES notation for 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane?
The canonical SMILES for 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane is CC(=CO)c1cnn2c(C)cc(C)nc12.CCCC1CCCCC1.CCCCCO.
What is the InChIKey of 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane?
The InChIKey is YGSZYMMFUPVAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.C9H18.C5H12O/c1-7(6-15)10-5-12-14-9(3)4-8(2)13-11(10)14;1-2-6-9-7-4-3-5-8-9;1-2-3-4-5-6/h4-6,15H,1-3H3;9H,2-8H2,1H3;6H,2-5H2,1H3.
What are the key properties of 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane?
2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane has a molecular weight of 417.64 g/mol, XLogP of 6.80, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)prop-1-en-1-ol;pentan-1-ol;propylcyclohexane is sourced from PubChem (CID 142613047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).