C22H25FN2O3 — CID 142613323
6-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(2-phenylmethoxyethyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 142613323) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 6-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(2-phenylmethoxyethyl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(2-phenylmethoxyethyl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 142613323 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 6-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(2-phenylmethoxyethyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | NC/C(=C/F)COc1ccc2c(c1)CCN(CCOCc1ccccc1)C2=O |
| InChI | InChI=1S/C22H25FN2O3/c23-13-18(14-24)16-28-20-6-7-21-19(12-20)8-9-25(22(21)26)10-11-27-15-17-4-2-1-3-5-17/h1-7,12-13H,8-11,14-16,24H2/b18-13- |
| InChIKey | INDMIWANZQCTOV-AQTBWJFISA-N |
| XLogP | 3.09 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|