C15H24SSi — CID 142613456
trimethyl-(2,3,4,5,6-pentamethylcyclopenta[b]thiophen-6-yl)silane (PubChem CID 142613456) has the molecular formula C15H24SSi and a molecular weight of 264.51 g/mol. Its IUPAC name is trimethyl-(2,3,4,5,6-pentamethylcyclopenta[b]thiophen-6-yl)silane.
| Compound Name | trimethyl-(2,3,4,5,6-pentamethylcyclopenta[b]thiophen-6-yl)silane |
|---|---|
| PubChem CID | 142613456 |
| Molecular Formula | C15H24SSi |
| Molecular Weight | 264.51 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | trimethyl-(2,3,4,5,6-pentamethylcyclopenta[b]thiophen-6-yl)silane |
| SMILES | CC1=C(C)C(C)([Si](C)(C)C)c2sc(C)c(C)c21 |
| InChI | InChI=1S/C15H24SSi/c1-9-11(3)15(5,17(6,7)8)14-13(9)10(2)12(4)16-14/h1-8H3 |
| InChIKey | OCPNOAJXTYGIKO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|