C19H16F3NO4S — CID 142613626
2-[1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid (PubChem CID 142613626) has the molecular formula C19H16F3NO4S and a molecular weight of 411.40 g/mol. Its IUPAC name is 2-[1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 142613626 |
| Molecular Formula | C19H16F3NO4S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-[1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid |
| SMILES | CS(=O)(=O)c1ccc(Cn2cc(CC(=O)O)c3ccccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3NO4S/c1-28(26,27)14-7-6-12(16(9-14)19(20,21)22)10-23-11-13(8-18(24)25)15-4-2-3-5-17(15)23/h2-7,9,11H,8,10H2,1H3,(H,24,25) |
| InChIKey | GRMKZDMDUQWLSP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |