C27H28N2O4S3 — CID 142613935
methyl 5-[2-[4-[(3S)-3-hydroxy-4-[3-(2-thiophen-3-ylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylate (PubChem CID 142613935) has the molecular formula C27H28N2O4S3 and a molecular weight of 540.73 g/mol. Its IUPAC name is methyl 5-[2-[4-[(3S)-3-hydroxy-4-[3-(2-thiophen-3-ylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[2-[4-[(3S)-3-hydroxy-4-[3-(2-thiophen-3-ylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 142613935 |
| Molecular Formula | C27H28N2O4S3 |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | methyl 5-[2-[4-[(3S)-3-hydroxy-4-[3-(2-thiophen-3-ylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCN2C(=O)SCCN2CC[C@@H](O)Cc2cccc(C#Cc3ccsc3)c2)s1 |
| InChI | InChI=1S/C27H28N2O4S3/c1-33-26(31)25-8-7-24(36-25)10-13-29-27(32)35-16-14-28(29)12-9-23(30)18-22-4-2-3-20(17-22)5-6-21-11-15-34-19-21/h2-4,7-8,11,15,17,19,23,30H,9-10,12-14,16,18H2,1H3/t23-/m1/s1 |
| InChIKey | YOAVHEUVDHWZJE-HSZRJFAPSA-N |
| XLogP | 4.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|