C28H28N2O4S2 — CID 142613936
5-[2-[4-[3-hydroxy-4-[3-(2-phenylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylic acid (PubChem CID 142613936) has the molecular formula C28H28N2O4S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is 5-[2-[4-[3-hydroxy-4-[3-(2-phenylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-[4-[3-hydroxy-4-[3-(2-phenylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 142613936 |
| Molecular Formula | C28H28N2O4S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 5-[2-[4-[3-hydroxy-4-[3-(2-phenylethynyl)phenyl]butyl]-2-oxo-1,3,4-thiadiazinan-3-yl]ethyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)SCCN2CCC(O)Cc2cccc(C#Cc3ccccc3)c2)s1 |
| InChI | InChI=1S/C28H28N2O4S2/c31-24(20-23-8-4-7-22(19-23)10-9-21-5-2-1-3-6-21)13-15-29-17-18-35-28(34)30(29)16-14-25-11-12-26(36-25)27(32)33/h1-8,11-12,19,24,31H,13-18,20H2,(H,32,33) |
| InChIKey | OGEBTVMVUNUUNQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|