C15H13F2NO2 — CID 142614271
2,6-difluoro-4-[4-methyl-2-[[(2S)-oxiran-2-yl]methoxy]phenyl]pyridine (PubChem CID 142614271) has the molecular formula C15H13F2NO2 and a molecular weight of 277.27 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-methyl-2-[[(2S)-oxiran-2-yl]methoxy]phenyl]pyridine.
| Compound Name | 2,6-difluoro-4-[4-methyl-2-[[(2S)-oxiran-2-yl]methoxy]phenyl]pyridine |
|---|---|
| PubChem CID | 142614271 |
| Molecular Formula | C15H13F2NO2 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2,6-difluoro-4-[4-methyl-2-[[(2S)-oxiran-2-yl]methoxy]phenyl]pyridine |
| SMILES | Cc1ccc(-c2cc(F)nc(F)c2)c(OC[C@@H]2CO2)c1 |
| InChI | InChI=1S/C15H13F2NO2/c1-9-2-3-12(10-5-14(16)18-15(17)6-10)13(4-9)20-8-11-7-19-11/h2-6,11H,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | FWNMRWHCTLTERS-NSHDSACASA-N |
| XLogP | 3.11 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|