C17H30O6S2Si — CID 14261491
O-[(3aR,5S,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methylsulfanylmethanethioate (PubChem CID 14261491) has the molecular formula C17H30O6S2Si and a molecular weight of 422.64 g/mol. Its IUPAC name is O-[(3aR,5S,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(3aR,5S,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 14261491 |
| Molecular Formula | C17H30O6S2Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | O-[(3aR,5S,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O6S2Si/c1-16(2,3)26(7,8)19-9-10(18)11-12(21-15(24)25-6)13-14(20-11)23-17(4,5)22-13/h11-14H,9H2,1-8H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | JZCREGKGYHHJCL-XJFOESAGSA-N |
| XLogP | 3.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|