About (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol
(2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol (PubChem CID 142615531) has the molecular formula C11H7ClF3NOS2
and a molecular weight of 325.76 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol |
| PubChem CID | 142615531 |
| Molecular Formula | C11H7ClF3NOS2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol |
| SMILES | OC(c1cccc(SC(F)(F)F)c1)c1cnc(Cl)s1 |
| InChI | InChI=1S/C11H7ClF3NOS2/c12-10-16-5-8(18-10)9(17)6-2-1-3-7(4-6)19-11(13,14)15/h1-5,9,17H |
| InChIKey | QWSVMRONVPFFDA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol?
The IUPAC name of (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol (CID 142615531) is (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol.
What is the SMILES notation for (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol?
The canonical SMILES for (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol is OC(c1cccc(SC(F)(F)F)c1)c1cnc(Cl)s1.
What is the InChIKey of (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol?
The InChIKey is QWSVMRONVPFFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClF3NOS2/c12-10-16-5-8(18-10)9(17)6-2-1-3-7(4-6)19-11(13,14)15/h1-5,9,17H.
What are the key properties of (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol?
(2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol has a molecular weight of 325.76 g/mol, XLogP of 4.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-5-yl)-[3-(trifluoromethylsulfanyl)phenyl]methanol is sourced from PubChem (CID 142615531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).