About 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine
3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine (PubChem CID 142615655) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine.
Molecular Properties
| Compound Name | 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine |
| PubChem CID | 142615655 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine |
| SMILES | CCCC1CCN(C)/C(=N\C)C1CC |
| InChI | InChI=1S/C12H24N2/c1-5-7-10-8-9-14(4)12(13-3)11(10)6-2/h10-11H,5-9H2,1-4H3/b13-12- |
| InChIKey | ZOBKQQZMTBDEKO-SEYXRHQNSA-N |
| XLogP | 2.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine?
The IUPAC name of 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine (CID 142615655) is 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine.
What is the SMILES notation for 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine?
The canonical SMILES for 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine is CCCC1CCN(C)/C(=N\C)C1CC.
What is the InChIKey of 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine?
The InChIKey is ZOBKQQZMTBDEKO-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H24N2/c1-5-7-10-8-9-14(4)12(13-3)11(10)6-2/h10-11H,5-9H2,1-4H3/b13-12-.
What are the key properties of 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine?
3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine has a molecular weight of 196.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,1-dimethyl-4-propylpiperidin-2-imine is sourced from PubChem (CID 142615655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).