About ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine
ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine (PubChem CID 142615692) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine |
| PubChem CID | 142615692 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine |
| SMILES | CC.CCN1CCC(N(C)CN)CC1 |
| InChI | InChI=1S/C9H21N3.C2H6/c1-3-12-6-4-9(5-7-12)11(2)8-10;1-2/h9H,3-8,10H2,1-2H3;1-2H3 |
| InChIKey | UPJHZNDVFQZVOH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine?
The IUPAC name of ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine (CID 142615692) is ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine.
What is the SMILES notation for ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine?
The canonical SMILES for ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine is CC.CCN1CCC(N(C)CN)CC1.
What is the InChIKey of ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine?
The InChIKey is UPJHZNDVFQZVOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3.C2H6/c1-3-12-6-4-9(5-7-12)11(2)8-10;1-2/h9H,3-8,10H2,1-2H3;1-2H3.
What are the key properties of ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine?
ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine has a molecular weight of 201.36 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-(1-ethylpiperidin-4-yl)-N'-methylmethanediamine is sourced from PubChem (CID 142615692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).