About N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine
N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine (PubChem CID 142615722) has the molecular formula C15H37N3O
and a molecular weight of 275.48 g/mol. Its IUPAC name is N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine.
Molecular Properties
| Compound Name | N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine |
| PubChem CID | 142615722 |
| Molecular Formula | C15H37N3O |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.29 |
| IUPAC Name | N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine |
| SMILES | CC.CCNCCN1CCOCC1.CNCC(C)C |
| InChI | InChI=1S/C8H18N2O.C5H13N.C2H6/c1-2-9-3-4-10-5-7-11-8-6-10;1-5(2)4-6-3;1-2/h9H,2-8H2,1H3;5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | IFMWIBHXWZQIFL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine?
The IUPAC name of N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine (CID 142615722) is N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine.
What is the SMILES notation for N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine?
The canonical SMILES for N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine is CC.CCNCCN1CCOCC1.CNCC(C)C.
What is the InChIKey of N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine?
The InChIKey is IFMWIBHXWZQIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.C5H13N.C2H6/c1-2-9-3-4-10-5-7-11-8-6-10;1-5(2)4-6-3;1-2/h9H,2-8H2,1H3;5-6H,4H2,1-3H3;1-2H3.
What are the key properties of N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine?
N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine has a molecular weight of 275.48 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylpropan-1-amine;ethane;N-ethyl-2-morpholin-4-ylethanamine is sourced from PubChem (CID 142615722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).