About 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one
1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one (PubChem CID 142615854) has the molecular formula C21H31N3O4
and a molecular weight of 389.50 g/mol. Its IUPAC name is 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 142615854 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC.CC(C)N1CCCC1=O.COc1cc2c(OC)nccc2cc1C(N)=O |
| InChI | InChI=1S/C12H12N2O3.C7H13NO.C2H6/c1-16-10-6-8-7(5-9(10)11(13)15)3-4-14-12(8)17-2;1-6(2)8-5-3-4-7(8)9;1-2/h3-6H,1-2H3,(H2,13,15);6H,3-5H2,1-2H3;1-2H3 |
| InChIKey | ZQAISHDUQLIDAM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one?
The IUPAC name of 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one (CID 142615854) is 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one is CC.CC(C)N1CCCC1=O.COc1cc2c(OC)nccc2cc1C(N)=O.
What is the InChIKey of 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one?
The InChIKey is ZQAISHDUQLIDAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3.C7H13NO.C2H6/c1-16-10-6-8-7(5-9(10)11(13)15)3-4-14-12(8)17-2;1-6(2)8-5-3-4-7(8)9;1-2/h3-6H,1-2H3,(H2,13,15);6H,3-5H2,1-2H3;1-2H3.
What are the key properties of 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one?
1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one has a molecular weight of 389.50 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethoxyisoquinoline-6-carboxamide;ethane;1-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 142615854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).