C14H31N3O2 — CID 142616193
acetamide;1-(2-cyclobutyloxyethyl)-4-ethylpiperazine;molecular hydrogen (PubChem CID 142616193) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is acetamide;1-(2-cyclobutyloxyethyl)-4-ethylpiperazine;molecular hydrogen.
| Compound Name | acetamide;1-(2-cyclobutyloxyethyl)-4-ethylpiperazine;molecular hydrogen |
|---|---|
| PubChem CID | 142616193 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | acetamide;1-(2-cyclobutyloxyethyl)-4-ethylpiperazine;molecular hydrogen |
| SMILES | CC(N)=O.CCN1CCN(CCOC2CCC2)CC1.[H][H] |
| InChI | InChI=1S/C12H24N2O.C2H5NO.H2/c1-2-13-6-8-14(9-7-13)10-11-15-12-4-3-5-12;1-2(3)4;/h12H,2-11H2,1H3;1H3,(H2,3,4);1H |
| InChIKey | KLXBBMWTCMVPEY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |