About 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate
2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate (PubChem CID 142616323) has the molecular formula C26H36FNO3
and a molecular weight of 429.58 g/mol. Its IUPAC name is 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate |
| PubChem CID | 142616323 |
| Molecular Formula | C26H36FNO3 |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate |
| SMILES | CC(C)COC(=O)CCOC(C)(C)C(F)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H36FNO3/c1-21(2)20-30-25(29)15-16-31-26(3,4)24(27)19-28(17-22-11-7-5-8-12-22)18-23-13-9-6-10-14-23/h5-14,21,24H,15-20H2,1-4H3 |
| InChIKey | TZCUNVAAEASIBG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate?
The IUPAC name of 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate (CID 142616323) is 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate.
What is the SMILES notation for 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate?
The canonical SMILES for 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate is CC(C)COC(=O)CCOC(C)(C)C(F)CN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate?
The InChIKey is TZCUNVAAEASIBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36FNO3/c1-21(2)20-30-25(29)15-16-31-26(3,4)24(27)19-28(17-22-11-7-5-8-12-22)18-23-13-9-6-10-14-23/h5-14,21,24H,15-20H2,1-4H3.
What are the key properties of 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate?
2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate has a molecular weight of 429.58 g/mol, XLogP of 5.41, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxypropanoate is sourced from PubChem (CID 142616323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).