About 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile
6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile (PubChem CID 142616827) has the molecular formula C20H19F2N5O
and a molecular weight of 383.40 g/mol. Its IUPAC name is 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile |
| PubChem CID | 142616827 |
| Molecular Formula | C20H19F2N5O |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)Cc3cc(F)c(C4CC4)c(F)c3)CC2)nn1 |
| InChI | InChI=1S/C20H19F2N5O/c21-16-9-13(10-17(22)20(16)14-1-2-14)11-19(28)27-7-5-26(6-8-27)18-4-3-15(12-23)24-25-18/h3-4,9-10,14H,1-2,5-8,11H2 |
| InChIKey | BXYCIYZZXWFMNC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile?
The IUPAC name of 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile (CID 142616827) is 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile.
What is the SMILES notation for 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile?
The canonical SMILES for 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile is N#Cc1ccc(N2CCN(C(=O)Cc3cc(F)c(C4CC4)c(F)c3)CC2)nn1.
What is the InChIKey of 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile?
The InChIKey is BXYCIYZZXWFMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2N5O/c21-16-9-13(10-17(22)20(16)14-1-2-14)11-19(28)27-7-5-26(6-8-27)18-4-3-15(12-23)24-25-18/h3-4,9-10,14H,1-2,5-8,11H2.
What are the key properties of 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile?
6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile has a molecular weight of 383.40 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[2-(4-cyclopropyl-3,5-difluorophenyl)acetyl]piperazin-1-yl]pyridazine-3-carbonitrile is sourced from PubChem (CID 142616827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).