About 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile
6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile (PubChem CID 142616833) has the molecular formula C12H12N4OS2
and a molecular weight of 292.39 g/mol. Its IUPAC name is 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile |
| PubChem CID | 142616833 |
| Molecular Formula | C12H12N4OS2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile |
| SMILES | CC(C)c1csc(CSOc2ccc(C#N)nn2)n1 |
| InChI | InChI=1S/C12H12N4OS2/c1-8(2)10-6-18-12(14-10)7-19-17-11-4-3-9(5-13)15-16-11/h3-4,6,8H,7H2,1-2H3 |
| InChIKey | DQNANENZVATNIQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile?
The IUPAC name of 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile (CID 142616833) is 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile.
What is the SMILES notation for 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile?
The canonical SMILES for 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile is CC(C)c1csc(CSOc2ccc(C#N)nn2)n1.
What is the InChIKey of 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile?
The InChIKey is DQNANENZVATNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4OS2/c1-8(2)10-6-18-12(14-10)7-19-17-11-4-3-9(5-13)15-16-11/h3-4,6,8H,7H2,1-2H3.
What are the key properties of 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile?
6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile has a molecular weight of 292.39 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-propan-2-yl-1,3-thiazol-2-yl)methylsulfanyloxy]pyridazine-3-carbonitrile is sourced from PubChem (CID 142616833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).