C21H34N4O4S2 — CID 142617315
N-(1,5-dimethylpyrrol-3-yl)-4-methyl-4-(methyldisulfanyl)pentanamide;N-(5-formyl-1-methylpyrrol-3-yl)formamide;methanol (PubChem CID 142617315) has the molecular formula C21H34N4O4S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is N-(1,5-dimethylpyrrol-3-yl)-4-methyl-4-(methyldisulfanyl)pentanamide;N-(5-formyl-1-methylpyrrol-3-yl)formamide;methanol.
| Compound Name | N-(1,5-dimethylpyrrol-3-yl)-4-methyl-4-(methyldisulfanyl)pentanamide;N-(5-formyl-1-methylpyrrol-3-yl)formamide;methanol |
|---|---|
| PubChem CID | 142617315 |
| Molecular Formula | C21H34N4O4S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-(1,5-dimethylpyrrol-3-yl)-4-methyl-4-(methyldisulfanyl)pentanamide;N-(5-formyl-1-methylpyrrol-3-yl)formamide;methanol |
| SMILES | CO.CSSC(C)(C)CCC(=O)Nc1cc(C)n(C)c1.Cn1cc(NC=O)cc1C=O |
| InChI | InChI=1S/C13H22N2OS2.C7H8N2O2.CH4O/c1-10-8-11(9-15(10)4)14-12(16)6-7-13(2,3)18-17-5;1-9-3-6(8-5-11)2-7(9)4-10;1-2/h8-9H,6-7H2,1-5H3,(H,14,16);2-5H,1H3,(H,8,11);2H,1H3 |
| InChIKey | URBWYGZZSXYDAG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|