C23H28N2O5 — CID 142617323
4-[5-[(2-formyl-3,4,7,8-tetrahydro-1H-isoquinolin-3-yl)methylideneamino]-2-methoxy-4-methylphenoxy]butanoic acid (PubChem CID 142617323) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[5-[(2-formyl-3,4,7,8-tetrahydro-1H-isoquinolin-3-yl)methylideneamino]-2-methoxy-4-methylphenoxy]butanoic acid.
| Compound Name | 4-[5-[(2-formyl-3,4,7,8-tetrahydro-1H-isoquinolin-3-yl)methylideneamino]-2-methoxy-4-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 142617323 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-[5-[(2-formyl-3,4,7,8-tetrahydro-1H-isoquinolin-3-yl)methylideneamino]-2-methoxy-4-methylphenoxy]butanoic acid |
| SMILES | COc1cc(C)c(/N=C/C2CC3=C(CCC=C3)CN2C=O)cc1OCCCC(=O)O |
| InChI | InChI=1S/C23H28N2O5/c1-16-10-21(29-2)22(30-9-5-8-23(27)28)12-20(16)24-13-19-11-17-6-3-4-7-18(17)14-25(19)15-26/h3,6,10,12-13,15,19H,4-5,7-9,11,14H2,1-2H3,(H,27,28)/b24-13+ |
| InChIKey | OLZHEVNIMISKMO-ZMOGYAJESA-N |
| XLogP | 3.83 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|