About 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione
5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione (PubChem CID 142618640) has the molecular formula C9H5Cl2NS2
and a molecular weight of 262.19 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione |
| PubChem CID | 142618640 |
| Molecular Formula | C9H5Cl2NS2 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 260.92 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]cc(-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C9H5Cl2NS2/c10-6-2-1-5(3-7(6)11)8-4-12-9(13)14-8/h1-4H,(H,12,13) |
| InChIKey | USMRKRVGXOXTEH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione?
The IUPAC name of 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione (CID 142618640) is 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione?
The canonical SMILES for 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione is S=c1[nH]cc(-c2ccc(Cl)c(Cl)c2)s1.
What is the InChIKey of 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione?
The InChIKey is USMRKRVGXOXTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2NS2/c10-6-2-1-5(3-7(6)11)8-4-12-9(13)14-8/h1-4H,(H,12,13).
What are the key properties of 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione?
5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione has a molecular weight of 262.19 g/mol, XLogP of 4.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dichlorophenyl)-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 142618640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).