About 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid
5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid (PubChem CID 142618744) has the molecular formula C12H12Cl2N4O2
and a molecular weight of 315.16 g/mol. Its IUPAC name is 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid |
| PubChem CID | 142618744 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid |
| SMILES | CCN(Cc1n[nH]nc1C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N4O2/c1-2-18(7-3-4-8(13)9(14)5-7)6-10-11(12(19)20)16-17-15-10/h3-5H,2,6H2,1H3,(H,19,20)(H,15,16,17) |
| InChIKey | KVRPLNGIHNEPKJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid?
The IUPAC name of 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid (CID 142618744) is 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid.
What is the SMILES notation for 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid?
The canonical SMILES for 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid is CCN(Cc1n[nH]nc1C(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid?
The InChIKey is KVRPLNGIHNEPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N4O2/c1-2-18(7-3-4-8(13)9(14)5-7)6-10-11(12(19)20)16-17-15-10/h3-5H,2,6H2,1H3,(H,19,20)(H,15,16,17).
What are the key properties of 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid?
5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid has a molecular weight of 315.16 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dichloro-N-ethylanilino)methyl]-2H-triazole-4-carboxylic acid is sourced from PubChem (CID 142618744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).