About 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one
2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 142619017) has the molecular formula C11H17FN2O
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one.
Molecular Properties
| Compound Name | 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
| PubChem CID | 142619017 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | O=C1NC(CCCCF)=NC12CCCC2 |
| InChI | InChI=1S/C11H17FN2O/c12-8-4-1-5-9-13-10(15)11(14-9)6-2-3-7-11/h1-8H2,(H,13,14,15) |
| InChIKey | UKFJCFGMRFIZSE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
The IUPAC name of 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one (CID 142619017) is 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one.
What is the SMILES notation for 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
The canonical SMILES for 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one is O=C1NC(CCCCF)=NC12CCCC2.
What is the InChIKey of 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
The InChIKey is UKFJCFGMRFIZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2O/c12-8-4-1-5-9-13-10(15)11(14-9)6-2-3-7-11/h1-8H2,(H,13,14,15).
What are the key properties of 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one has a molecular weight of 212.27 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorobutyl)-1,3-diazaspiro[4.4]non-1-en-4-one is sourced from PubChem (CID 142619017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).