C32H28N2O — CID 142619051
(Z)-but-2-ene;2-[(E)-but-2-en-2-yl]-4-naphtho[1,2-b][1]benzofuran-4-ylquinazoline (PubChem CID 142619051) has the molecular formula C32H28N2O and a molecular weight of 456.59 g/mol. Its IUPAC name is (Z)-but-2-ene;2-[(E)-but-2-en-2-yl]-4-naphtho[1,2-b][1]benzofuran-4-ylquinazoline.
| Compound Name | (Z)-but-2-ene;2-[(E)-but-2-en-2-yl]-4-naphtho[1,2-b][1]benzofuran-4-ylquinazoline |
|---|---|
| PubChem CID | 142619051 |
| Molecular Formula | C32H28N2O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (Z)-but-2-ene;2-[(E)-but-2-en-2-yl]-4-naphtho[1,2-b][1]benzofuran-4-ylquinazoline |
| SMILES | C/C=C(\C)c1nc(-c2cccc3c2ccc2c4ccccc4oc32)c2ccccc2n1.C/C=C\C |
| InChI | InChI=1S/C28H20N2O.C4H8/c1-3-17(2)28-29-24-13-6-4-10-23(24)26(30-28)20-11-8-12-21-18(20)15-16-22-19-9-5-7-14-25(19)31-27(21)22;1-3-4-2/h3-16H,1-2H3;3-4H,1-2H3/b17-3+;4-3- |
| InChIKey | LMENGVHVRCKBHZ-DKBWYRQISA-N |
| XLogP | 9.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|