C11H15NO2 — CID 142619078
N-hydroxy-2-(2-propan-2-ylphenyl)acetamide (PubChem CID 142619078) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-hydroxy-2-(2-propan-2-ylphenyl)acetamide.
| Compound Name | N-hydroxy-2-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 142619078 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-hydroxy-2-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1CC(=O)NO |
| InChI | InChI=1S/C11H15NO2/c1-8(2)10-6-4-3-5-9(10)7-11(13)12-14/h3-6,8,14H,7H2,1-2H3,(H,12,13) |
| InChIKey | MMPJIJIMSQCMPX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|