About 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione
7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione (PubChem CID 142619125) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione.
Molecular Properties
| Compound Name | 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
| PubChem CID | 142619125 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
| SMILES | O=C1CCC2(C=CC(=O)C(Br)=C2)N1 |
| InChI | InChI=1S/C9H8BrNO2/c10-6-5-9(3-1-7(6)12)4-2-8(13)11-9/h1,3,5H,2,4H2,(H,11,13) |
| InChIKey | FXSDFAGQQKKLSU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione?
The IUPAC name of 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione (CID 142619125) is 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione.
What is the SMILES notation for 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione?
The canonical SMILES for 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione is O=C1CCC2(C=CC(=O)C(Br)=C2)N1.
What is the InChIKey of 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione?
The InChIKey is FXSDFAGQQKKLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2/c10-6-5-9(3-1-7(6)12)4-2-8(13)11-9/h1,3,5H,2,4H2,(H,11,13).
What are the key properties of 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione?
7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione has a molecular weight of 242.07 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-azaspiro[4.5]deca-6,9-diene-2,8-dione is sourced from PubChem (CID 142619125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).