C9H14N2 — CID 142619168
N-(5-ethenyl-1-methyl-3,4-dihydro-2H-pyridin-6-yl)methanimine (PubChem CID 142619168) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-(5-ethenyl-1-methyl-3,4-dihydro-2H-pyridin-6-yl)methanimine.
| Compound Name | N-(5-ethenyl-1-methyl-3,4-dihydro-2H-pyridin-6-yl)methanimine |
|---|---|
| PubChem CID | 142619168 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-(5-ethenyl-1-methyl-3,4-dihydro-2H-pyridin-6-yl)methanimine |
| SMILES | C=CC1=C(N=C)N(C)CCC1 |
| InChI | InChI=1S/C9H14N2/c1-4-8-6-5-7-11(3)9(8)10-2/h4H,1-2,5-7H2,3H3 |
| InChIKey | VRYLVJDJUCDHFM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|