About 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane
2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane (PubChem CID 142620351) has the molecular formula C8H9Cl2NSSi
and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane |
| PubChem CID | 142620351 |
| Molecular Formula | C8H9Cl2NSSi |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1nc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C8H9Cl2NSSi/c1-13(2,3)5-4-6-11-7(9)8(10)12-6/h1-3H3 |
| InChIKey | MFBXAUUJBVLYJL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane?
The IUPAC name of 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane (CID 142620351) is 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane.
What is the SMILES notation for 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane?
The canonical SMILES for 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane is C[Si](C)(C)C#Cc1nc(Cl)c(Cl)s1.
What is the InChIKey of 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane?
The InChIKey is MFBXAUUJBVLYJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2NSSi/c1-13(2,3)5-4-6-11-7(9)8(10)12-6/h1-3H3.
What are the key properties of 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane?
2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane has a molecular weight of 250.23 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dichloro-1,3-thiazol-2-yl)ethynyl-trimethylsilane is sourced from PubChem (CID 142620351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).