C40H26N2O — CID 142620415
5,7-bis(4-ethenylphenyl)-17-phenyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaen-11-one (PubChem CID 142620415) has the molecular formula C40H26N2O and a molecular weight of 550.66 g/mol. Its IUPAC name is 5,7-bis(4-ethenylphenyl)-17-phenyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaen-11-one.
| Compound Name | 5,7-bis(4-ethenylphenyl)-17-phenyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaen-11-one |
|---|---|
| PubChem CID | 142620415 |
| Molecular Formula | C40H26N2O |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 5,7-bis(4-ethenylphenyl)-17-phenyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaen-11-one |
| SMILES | C=Cc1ccc(-c2cc(-c3ccc(C=C)cc3)c3nc4c5ccc(-c6ccccc6)c6cccc(c(=O)n4c3c2)c65)cc1 |
| InChI | InChI=1S/C40H26N2O/c1-3-25-13-17-27(18-14-25)30-23-35(29-19-15-26(4-2)16-20-29)38-36(24-30)42-39(41-38)33-22-21-31(28-9-6-5-7-10-28)32-11-8-12-34(37(32)33)40(42)43/h3-24H,1-2H2 |
| InChIKey | LADDYUYPOQNPDP-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |