C29H41FN4O3 — CID 142620546
(Z)-2-[3-(tert-butylamino)propoxy]-1-[2-[cyclooctyl-(3-methyl-1,2-oxazol-4-yl)methyl]-4-fluoro-1H-benzimidazol-5-yl]ethenol (PubChem CID 142620546) has the molecular formula C29H41FN4O3 and a molecular weight of 512.67 g/mol. Its IUPAC name is (Z)-2-[3-(tert-butylamino)propoxy]-1-[2-[cyclooctyl-(3-methyl-1,2-oxazol-4-yl)methyl]-4-fluoro-1H-benzimidazol-5-yl]ethenol.
| Compound Name | (Z)-2-[3-(tert-butylamino)propoxy]-1-[2-[cyclooctyl-(3-methyl-1,2-oxazol-4-yl)methyl]-4-fluoro-1H-benzimidazol-5-yl]ethenol |
|---|---|
| PubChem CID | 142620546 |
| Molecular Formula | C29H41FN4O3 |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | (Z)-2-[3-(tert-butylamino)propoxy]-1-[2-[cyclooctyl-(3-methyl-1,2-oxazol-4-yl)methyl]-4-fluoro-1H-benzimidazol-5-yl]ethenol |
| SMILES | Cc1nocc1C(c1nc2c(F)c(/C(O)=C/OCCCNC(C)(C)C)ccc2[nH]1)C1CCCCCCC1 |
| InChI | InChI=1S/C29H41FN4O3/c1-19-22(17-37-34-19)25(20-11-8-6-5-7-9-12-20)28-32-23-14-13-21(26(30)27(23)33-28)24(35)18-36-16-10-15-31-29(2,3)4/h13-14,17-18,20,25,31,35H,5-12,15-16H2,1-4H3,(H,32,33)/b24-18- |
| InChIKey | WHOFAUSJRBJPGN-MOHJPFBDSA-N |
| XLogP | 7.14 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|