C22H48N2O — CID 142621085
2-hexyl-6-(8-methylnonoxy)hexane-1,3-diamine (PubChem CID 142621085) has the molecular formula C22H48N2O and a molecular weight of 356.64 g/mol. Its IUPAC name is 2-hexyl-6-(8-methylnonoxy)hexane-1,3-diamine.
| Compound Name | 2-hexyl-6-(8-methylnonoxy)hexane-1,3-diamine |
|---|---|
| PubChem CID | 142621085 |
| Molecular Formula | C22H48N2O |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.38 |
| IUPAC Name | 2-hexyl-6-(8-methylnonoxy)hexane-1,3-diamine |
| SMILES | CCCCCCC(CN)C(N)CCCOCCCCCCCC(C)C |
| InChI | InChI=1S/C22H48N2O/c1-4-5-6-11-15-21(19-23)22(24)16-13-18-25-17-12-9-7-8-10-14-20(2)3/h20-22H,4-19,23-24H2,1-3H3 |
| InChIKey | GHGMVAUYWRQUSY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|